C16H14FN2O3+ — CID 150716211
3-(2-fluoro-3-methoxyphenyl)-2-hydroxy-1-methylpyrido[1,2-a]pyrimidin-1-ium-4-one (PubChem CID 150716211) has the molecular formula C16H14FN2O3+ and a molecular weight of 301.30 g/mol. Its IUPAC name is 3-(2-fluoro-3-methoxyphenyl)-2-hydroxy-1-methylpyrido[1,2-a]pyrimidin-1-ium-4-one.
| Compound Name | 3-(2-fluoro-3-methoxyphenyl)-2-hydroxy-1-methylpyrido[1,2-a]pyrimidin-1-ium-4-one |
|---|---|
| PubChem CID | 150716211 |
| Molecular Formula | C16H14FN2O3+ |
| Molecular Weight | 301.30 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | 3-(2-fluoro-3-methoxyphenyl)-2-hydroxy-1-methylpyrido[1,2-a]pyrimidin-1-ium-4-one |
| SMILES | COc1cccc(-c2c(O)[n+](C)c3ccccn3c2=O)c1F |
| InChI | InChI=1S/C16H13FN2O3/c1-18-12-8-3-4-9-19(12)16(21)13(15(18)20)10-6-5-7-11(22-2)14(10)17/h3-9H,1-2H3/p+1 |
| InChIKey | JOXVUUMZGPOJIA-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.30 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|