About 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid
4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid (PubChem CID 150716679) has the molecular formula C18H30O4
and a molecular weight of 310.43 g/mol. Its IUPAC name is 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid |
| PubChem CID | 150716679 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid |
| SMILES | CCC(C)COC(=O)C1=C(C(=O)O)C(C)(C)C(C)C(CC)C1 |
| InChI | InChI=1S/C18H30O4/c1-7-11(3)10-22-17(21)14-9-13(8-2)12(4)18(5,6)15(14)16(19)20/h11-13H,7-10H2,1-6H3,(H,19,20) |
| InChIKey | JPADDFCFUZHBKA-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid?
The IUPAC name of 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid (CID 150716679) is 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid.
What is the SMILES notation for 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid?
The canonical SMILES for 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid is CCC(C)COC(=O)C1=C(C(=O)O)C(C)(C)C(C)C(CC)C1.
What is the InChIKey of 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid?
The InChIKey is JPADDFCFUZHBKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H30O4/c1-7-11(3)10-22-17(21)14-9-13(8-2)12(4)18(5,6)15(14)16(19)20/h11-13H,7-10H2,1-6H3,(H,19,20).
What are the key properties of 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid?
4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid has a molecular weight of 310.43 g/mol, XLogP of 4.05, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-5,6,6-trimethyl-2-(2-methylbutoxycarbonyl)cyclohexene-1-carboxylic acid is sourced from PubChem (CID 150716679), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).