C9H13CoN — CID 150721318
cobalt(2+);2-methylpropanenitrile;penta-1,3-diene (PubChem CID 150721318) has the molecular formula C9H13CoN and a molecular weight of 194.14 g/mol. Its IUPAC name is cobalt(2+);2-methylpropanenitrile;penta-1,3-diene.
| Compound Name | cobalt(2+);2-methylpropanenitrile;penta-1,3-diene |
|---|---|
| PubChem CID | 150721318 |
| Molecular Formula | C9H13CoN |
| Molecular Weight | 194.14 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | cobalt(2+);2-methylpropanenitrile;penta-1,3-diene |
| SMILES | C[C-](C)C#N.[Co+2].[H]/[C-]=C\C=CC |
| InChI | InChI=1S/C5H7.C4H6N.Co/c1-3-5-4-2;1-4(2)3-5;/h1,3-5H,2H3;1-2H3;/q2*-1;+2 |
| InChIKey | JPXNDCWZYCQETP-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.14 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|