About 2-ethylhexyl N-butylcarbamate
2-ethylhexyl N-butylcarbamate (PubChem CID 15072171) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-ethylhexyl N-butylcarbamate.
Molecular Properties
| Compound Name | 2-ethylhexyl N-butylcarbamate |
| PubChem CID | 15072171 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-ethylhexyl N-butylcarbamate |
| SMILES | CCCCNC(=O)OCC(CC)CCCC |
| InChI | InChI=1S/C13H27NO2/c1-4-7-9-12(6-3)11-16-13(15)14-10-8-5-2/h12H,4-11H2,1-3H3,(H,14,15) |
| InChIKey | VBLNBASBINMWJE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethylhexyl N-butylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexyl N-butylcarbamate?
The IUPAC name of 2-ethylhexyl N-butylcarbamate (CID 15072171) is 2-ethylhexyl N-butylcarbamate.
What is the SMILES notation for 2-ethylhexyl N-butylcarbamate?
The canonical SMILES for 2-ethylhexyl N-butylcarbamate is CCCCNC(=O)OCC(CC)CCCC.
What is the InChIKey of 2-ethylhexyl N-butylcarbamate?
The InChIKey is VBLNBASBINMWJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-4-7-9-12(6-3)11-16-13(15)14-10-8-5-2/h12H,4-11H2,1-3H3,(H,14,15).
What are the key properties of 2-ethylhexyl N-butylcarbamate?
2-ethylhexyl N-butylcarbamate has a molecular weight of 229.36 g/mol, XLogP of 3.73, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexyl N-butylcarbamate is sourced from PubChem (CID 15072171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).