C34H60O6PS+ — CID 150721911
[1-(3-decylsulfanyldodecan-2-ylperoxy)-2-oxo-2-phenylmethoxy-1-propoxyethyl]-oxophosphanium (PubChem CID 150721911) has the molecular formula C34H60O6PS+ and a molecular weight of 627.89 g/mol. Its IUPAC name is [1-(3-decylsulfanyldodecan-2-ylperoxy)-2-oxo-2-phenylmethoxy-1-propoxyethyl]-oxophosphanium.
| Compound Name | [1-(3-decylsulfanyldodecan-2-ylperoxy)-2-oxo-2-phenylmethoxy-1-propoxyethyl]-oxophosphanium |
|---|---|
| PubChem CID | 150721911 |
| Molecular Formula | C34H60O6PS+ |
| Molecular Weight | 627.89 g/mol |
| Exact Mass | 627.38 |
| IUPAC Name | [1-(3-decylsulfanyldodecan-2-ylperoxy)-2-oxo-2-phenylmethoxy-1-propoxyethyl]-oxophosphanium |
| SMILES | CCCCCCCCCCSC(CCCCCCCCC)C(C)OOC(OCCC)([PH+]=O)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C34H59O6PS/c1-5-8-10-12-14-16-18-23-28-42-32(26-22-17-15-13-11-9-6-2)30(4)39-40-34(41-36,38-27-7-3)33(35)37-29-31-24-20-19-21-25-31/h19-21,24-25,30,32H,5-18,22-23,26-29H2,1-4H3/p+1 |
| InChIKey | JQALWZRQEGLXPP-UHFFFAOYSA-O |
| XLogP | 10.55 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.89 |
| LogP ≤ 5 | 10.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|