C30H29N5O2 — CID 150722293
3-[(1Z)-1-[6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-7-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]-4H-1,2,4-oxadiazol-5-one (PubChem CID 150722293) has the molecular formula C30H29N5O2 and a molecular weight of 491.60 g/mol. Its IUPAC name is 3-[(1Z)-1-[6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-7-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]-4H-1,2,4-oxadiazol-5-one.
| Compound Name | 3-[(1Z)-1-[6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-7-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]-4H-1,2,4-oxadiazol-5-one |
|---|---|
| PubChem CID | 150722293 |
| Molecular Formula | C30H29N5O2 |
| Molecular Weight | 491.60 g/mol |
| Exact Mass | 491.23 |
| IUPAC Name | 3-[(1Z)-1-[6-(2-ethyl-5,7-dimethylimidazo[4,5-b]pyridin-3-yl)-7-methyl-2-tricyclo[9.4.0.03,8]pentadeca-1(15),3(8),4,6,11,13-hexaenylidene]ethyl]-4H-1,2,4-oxadiazol-5-one |
| SMILES | CCc1nc2c(C)cc(C)nc2n1-c1ccc2c(c1C)CCc1ccccc1/C2=C(\C)c1noc(=O)[nH]1 |
| InChI | InChI=1S/C30H29N5O2/c1-6-25-32-27-16(2)15-17(3)31-29(27)35(25)24-14-13-23-21(18(24)4)12-11-20-9-7-8-10-22(20)26(23)19(5)28-33-30(36)37-34-28/h7-10,13-15H,6,11-12H2,1-5H3,(H,33,34,36)/b26-19- |
| InChIKey | JQCODHZHXUDLPK-XHPQRKPJSA-N |
| XLogP | 5.66 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.60 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'styrene_A(13)', 'substructure': 'N/A'} |
|---|