C24H30BrF5N4O2Si — CID 150731625
N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluorophenyl]-4-(trifluoromethyl)-6-(2-trimethylsilylethoxy)pyridine-3-carboxamide (PubChem CID 150731625) has the molecular formula C24H30BrF5N4O2Si and a molecular weight of 609.51 g/mol. Its IUPAC name is N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluorophenyl]-4-(trifluoromethyl)-6-(2-trimethylsilylethoxy)pyridine-3-carboxamide.
| Compound Name | N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluorophenyl]-4-(trifluoromethyl)-6-(2-trimethylsilylethoxy)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 150731625 |
| Molecular Formula | C24H30BrF5N4O2Si |
| Molecular Weight | 609.51 g/mol |
| Exact Mass | 608.12 |
| IUPAC Name | N-[3-bromo-6-[(3S)-3,4-dimethylpiperazin-1-yl]-2,4-difluorophenyl]-4-(trifluoromethyl)-6-(2-trimethylsilylethoxy)pyridine-3-carboxamide |
| SMILES | C[C@H]1CN(c2cc(F)c(Br)c(F)c2NC(=O)c2cnc(OCC[Si](C)(C)C)cc2C(F)(F)F)CCN1C |
| InChI | InChI=1S/C24H30BrF5N4O2Si/c1-14-13-34(7-6-33(14)2)18-11-17(26)20(25)21(27)22(18)32-23(35)15-12-31-19(10-16(15)24(28,29)30)36-8-9-37(3,4)5/h10-12,14H,6-9,13H2,1-5H3,(H,32,35)/t14-/m0/s1 |
| InChIKey | JRYOESUJKBDUAW-AWEZNQCLSA-N |
| XLogP | 6.25 |
| TPSA | 57.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.51 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|