About 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide
5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide (PubChem CID 15073790) has the molecular formula C6H10O2S
and a molecular weight of 146.21 g/mol. Its IUPAC name is 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide.
Molecular Properties
| Compound Name | 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide |
| PubChem CID | 15073790 |
| Molecular Formula | C6H10O2S |
| Molecular Weight | 146.21 g/mol |
| Exact Mass | 146.04 |
| IUPAC Name | 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide |
| SMILES | CC1=C(C)S(=O)CCO1 |
| InChI | InChI=1S/C6H10O2S/c1-5-6(2)9(7)4-3-8-5/h3-4H2,1-2H3 |
| InChIKey | BFJGJZIYHGNLLL-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.21 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide?
The IUPAC name of 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide (CID 15073790) is 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide.
What is the SMILES notation for 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide?
The canonical SMILES for 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide is CC1=C(C)S(=O)CCO1.
What is the InChIKey of 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide?
The InChIKey is BFJGJZIYHGNLLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2S/c1-5-6(2)9(7)4-3-8-5/h3-4H2,1-2H3.
What are the key properties of 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide?
5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide has a molecular weight of 146.21 g/mol, XLogP of 1.02, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-2,3-dihydro-1,4-oxathiine 4-oxide is sourced from PubChem (CID 15073790), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).