C13H21N3O2 — CID 150739677
1-[4-(4-amino-4-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]ethanone (PubChem CID 150739677) has the molecular formula C13H21N3O2 and a molecular weight of 251.33 g/mol. Its IUPAC name is 1-[4-(4-amino-4-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]ethanone.
| Compound Name | 1-[4-(4-amino-4-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 150739677 |
| Molecular Formula | C13H21N3O2 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | 1-[4-(4-amino-4-methoxycyclohexa-1,5-dien-1-yl)piperazin-1-yl]ethanone |
| SMILES | COC1(N)C=CC(N2CCN(C(C)=O)CC2)=CC1 |
| InChI | InChI=1S/C13H21N3O2/c1-11(17)15-7-9-16(10-8-15)12-3-5-13(14,18-2)6-4-12/h3-5H,6-10,14H2,1-2H3 |
| InChIKey | JTOPQSKYZSNIEI-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|