About tributyl-(3,6-diphenylpyridazin-4-yl)stannane
tributyl-(3,6-diphenylpyridazin-4-yl)stannane (PubChem CID 15074354) has the molecular formula C28H38N2Sn
and a molecular weight of 521.34 g/mol. Its IUPAC name is tributyl-(3,6-diphenylpyridazin-4-yl)stannane.
Molecular Properties
| Compound Name | tributyl-(3,6-diphenylpyridazin-4-yl)stannane |
| PubChem CID | 15074354 |
| Molecular Formula | C28H38N2Sn |
| Molecular Weight | 521.34 g/mol |
| Exact Mass | 522.21 |
| IUPAC Name | tributyl-(3,6-diphenylpyridazin-4-yl)stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc(-c2ccccc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C16H11N2.3C4H9.Sn/c1-3-7-13(8-4-1)15-11-12-16(18-17-15)14-9-5-2-6-10-14;3*1-3-4-2;/h1-11H;3*1,3-4H2,2H3; |
| InChIKey | JYEYCVOGQNVMOC-UHFFFAOYSA-N |
| XLogP | 7.87 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 521.34 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze tributyl-(3,6-diphenylpyridazin-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tributyl-(3,6-diphenylpyridazin-4-yl)stannane?
The IUPAC name of tributyl-(3,6-diphenylpyridazin-4-yl)stannane (CID 15074354) is tributyl-(3,6-diphenylpyridazin-4-yl)stannane.
What is the SMILES notation for tributyl-(3,6-diphenylpyridazin-4-yl)stannane?
The canonical SMILES for tributyl-(3,6-diphenylpyridazin-4-yl)stannane is CCCC[Sn](CCCC)(CCCC)c1cc(-c2ccccc2)nnc1-c1ccccc1.
What is the InChIKey of tributyl-(3,6-diphenylpyridazin-4-yl)stannane?
The InChIKey is JYEYCVOGQNVMOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H11N2.3C4H9.Sn/c1-3-7-13(8-4-1)15-11-12-16(18-17-15)14-9-5-2-6-10-14;3*1-3-4-2;/h1-11H;3*1,3-4H2,2H3;.
What are the key properties of tributyl-(3,6-diphenylpyridazin-4-yl)stannane?
tributyl-(3,6-diphenylpyridazin-4-yl)stannane has a molecular weight of 521.34 g/mol, XLogP of 7.87, 12 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tributyl-(3,6-diphenylpyridazin-4-yl)stannane is sourced from PubChem (CID 15074354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).