C22H19BClFN4O3 — CID 150744417
[6-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]boronic acid (PubChem CID 150744417) has the molecular formula C22H19BClFN4O3 and a molecular weight of 452.68 g/mol. Its IUPAC name is [6-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]boronic acid.
| Compound Name | [6-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]boronic acid |
|---|---|
| PubChem CID | 150744417 |
| Molecular Formula | C22H19BClFN4O3 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.12 |
| IUPAC Name | [6-[3-(5-chloro-2-fluorophenyl)-1-(oxan-2-yl)pyrazol-4-yl]-1,5-naphthyridin-3-yl]boronic acid |
| SMILES | OB(O)c1cnc2ccc(-c3cn(C4CCCCO4)nc3-c3cc(Cl)ccc3F)nc2c1 |
| InChI | InChI=1S/C22H19BClFN4O3/c24-14-4-5-17(25)15(10-14)22-16(12-29(28-22)21-3-1-2-8-32-21)18-6-7-19-20(27-18)9-13(11-26-19)23(30)31/h4-7,9-12,21,30-31H,1-3,8H2 |
| InChIKey | JUNNGRPIEHRLNH-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 93.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|