C16H20O4 — CID 15074640
4-but-1-ynyl-4-hex-2-ynoxy-2,3-dimethoxycyclobut-2-en-1-one (PubChem CID 15074640) has the molecular formula C16H20O4 and a molecular weight of 276.33 g/mol. Its IUPAC name is 4-but-1-ynyl-4-hex-2-ynoxy-2,3-dimethoxycyclobut-2-en-1-one.
| Compound Name | 4-but-1-ynyl-4-hex-2-ynoxy-2,3-dimethoxycyclobut-2-en-1-one |
|---|---|
| PubChem CID | 15074640 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | 4-but-1-ynyl-4-hex-2-ynoxy-2,3-dimethoxycyclobut-2-en-1-one |
| SMILES | CCC#CC1(OCC#CCCC)C(=O)C(OC)=C1OC |
| InChI | InChI=1S/C16H20O4/c1-5-7-9-10-12-20-16(11-8-6-2)14(17)13(18-3)15(16)19-4/h5-7,12H2,1-4H3 |
| InChIKey | MZYJKNCUPYSKST-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|