About 2-(2-aminophenyl)aniline
2-(2-aminophenyl)aniline (PubChem CID 15075) has the molecular formula C12H12N2
and a molecular weight of 184.24 g/mol. Its IUPAC name is 2-(2-aminophenyl)aniline.
Molecular Properties
| Compound Name | 2-(2-aminophenyl)aniline |
| PubChem CID | 15075 |
| Molecular Formula | C12H12N2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.10 |
| IUPAC Name | 2-(2-aminophenyl)aniline |
| SMILES | Nc1ccccc1-c1ccccc1N |
| InChI | InChI=1S/C12H12N2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H,13-14H2 |
| InChIKey | HOLGXWDGCVTMTB-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-aminophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-aminophenyl)aniline?
The IUPAC name of 2-(2-aminophenyl)aniline (CID 15075) is 2-(2-aminophenyl)aniline.
What is the SMILES notation for 2-(2-aminophenyl)aniline?
The canonical SMILES for 2-(2-aminophenyl)aniline is Nc1ccccc1-c1ccccc1N.
What is the InChIKey of 2-(2-aminophenyl)aniline?
The InChIKey is HOLGXWDGCVTMTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8H,13-14H2.
What are the key properties of 2-(2-aminophenyl)aniline?
2-(2-aminophenyl)aniline has a molecular weight of 184.24 g/mol, XLogP of 2.52, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-aminophenyl)aniline is sourced from PubChem (CID 15075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).