About dichlorotungsten;nonane;phenol
dichlorotungsten;nonane;phenol (PubChem CID 150757460) has the molecular formula C15H25Cl2OW-
and a molecular weight of 476.11 g/mol. Its IUPAC name is dichlorotungsten;nonane;phenol.
Molecular Properties
| Compound Name | dichlorotungsten;nonane;phenol |
| PubChem CID | 150757460 |
| Molecular Formula | C15H25Cl2OW- |
| Molecular Weight | 476.11 g/mol |
| Exact Mass | 475.08 |
| IUPAC Name | dichlorotungsten;nonane;phenol |
| SMILES | Cl[W]Cl.Oc1ccccc1.[CH2-]CCCCCCCC |
| InChI | InChI=1S/C9H19.C6H6O.2ClH.W/c1-3-5-7-9-8-6-4-2;7-6-4-2-1-3-5-6;;;/h1,3-9H2,2H3;1-5,7H;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | IXSQOQXSSUJXGB-UHFFFAOYSA-L |
| XLogP | 6.34 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 476.11 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze dichlorotungsten;nonane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichlorotungsten;nonane;phenol?
The IUPAC name of dichlorotungsten;nonane;phenol (CID 150757460) is dichlorotungsten;nonane;phenol.
What is the SMILES notation for dichlorotungsten;nonane;phenol?
The canonical SMILES for dichlorotungsten;nonane;phenol is Cl[W]Cl.Oc1ccccc1.[CH2-]CCCCCCCC.
What is the InChIKey of dichlorotungsten;nonane;phenol?
The InChIKey is IXSQOQXSSUJXGB-UHFFFAOYSA-L. The full InChI is InChI=1S/C9H19.C6H6O.2ClH.W/c1-3-5-7-9-8-6-4-2;7-6-4-2-1-3-5-6;;;/h1,3-9H2,2H3;1-5,7H;2*1H;/q-1;;;;+2/p-2.
What are the key properties of dichlorotungsten;nonane;phenol?
dichlorotungsten;nonane;phenol has a molecular weight of 476.11 g/mol, XLogP of 6.34, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dichlorotungsten;nonane;phenol is sourced from PubChem (CID 150757460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).