C13H14N2O2 — CID 15075929
2,3,4,4a,5,11-hexahydropyrido[1,2-b][2,4]benzodiazepine-1,6-dione (PubChem CID 15075929) has the molecular formula C13H14N2O2 and a molecular weight of 230.27 g/mol. Its IUPAC name is 2,3,4,4a,5,11-hexahydropyrido[1,2-b][2,4]benzodiazepine-1,6-dione.
| Compound Name | 2,3,4,4a,5,11-hexahydropyrido[1,2-b][2,4]benzodiazepine-1,6-dione |
|---|---|
| PubChem CID | 15075929 |
| Molecular Formula | C13H14N2O2 |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.11 |
| IUPAC Name | 2,3,4,4a,5,11-hexahydropyrido[1,2-b][2,4]benzodiazepine-1,6-dione |
| SMILES | O=C1NC2CCCC(=O)N2Cc2ccccc21 |
| InChI | InChI=1S/C13H14N2O2/c16-12-7-3-6-11-14-13(17)10-5-2-1-4-9(10)8-15(11)12/h1-2,4-5,11H,3,6-8H2,(H,14,17) |
| InChIKey | RYWCRXSOKKVTFI-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |