About 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine
5-piperidin-4-yloxypyrazolo[1,5-a]pyridine (PubChem CID 150759594) has the molecular formula C12H15N3O
and a molecular weight of 217.27 g/mol. Its IUPAC name is 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine.
Molecular Properties
| Compound Name | 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine |
| PubChem CID | 150759594 |
| Molecular Formula | C12H15N3O |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.12 |
| IUPAC Name | 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine |
| SMILES | c1cc2cc(OC3CCNCC3)ccn2n1 |
| InChI | InChI=1S/C12H15N3O/c1-7-14-15-8-4-12(9-10(1)15)16-11-2-5-13-6-3-11/h1,4,7-9,11,13H,2-3,5-6H2 |
| InChIKey | JXOIBTAXFIXGFG-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine?
The IUPAC name of 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine (CID 150759594) is 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine.
What is the SMILES notation for 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine?
The canonical SMILES for 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine is c1cc2cc(OC3CCNCC3)ccn2n1.
What is the InChIKey of 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine?
The InChIKey is JXOIBTAXFIXGFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O/c1-7-14-15-8-4-12(9-10(1)15)16-11-2-5-13-6-3-11/h1,4,7-9,11,13H,2-3,5-6H2.
What are the key properties of 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine?
5-piperidin-4-yloxypyrazolo[1,5-a]pyridine has a molecular weight of 217.27 g/mol, XLogP of 1.47, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-piperidin-4-yloxypyrazolo[1,5-a]pyridine is sourced from PubChem (CID 150759594), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).