C7H10N4O2 — CID 150760661
1,5-dimethyl-4,7-dihydro-3H-purine-2,6-dione (PubChem CID 150760661) has the molecular formula C7H10N4O2 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1,5-dimethyl-4,7-dihydro-3H-purine-2,6-dione.
| Compound Name | 1,5-dimethyl-4,7-dihydro-3H-purine-2,6-dione |
|---|---|
| PubChem CID | 150760661 |
| Molecular Formula | C7H10N4O2 |
| Molecular Weight | 182.18 g/mol |
| Exact Mass | 182.08 |
| IUPAC Name | 1,5-dimethyl-4,7-dihydro-3H-purine-2,6-dione |
| SMILES | CN1C(=O)NC2N=CNC2(C)C1=O |
| InChI | InChI=1S/C7H10N4O2/c1-7-4(8-3-9-7)10-6(13)11(2)5(7)12/h3-4H,1-2H3,(H,8,9)(H,10,13) |
| InChIKey | JXTPNGGTDJTDML-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.18 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |