About 4,5-dihydro-1H-imidazole-4,5-dithiol
4,5-dihydro-1H-imidazole-4,5-dithiol (PubChem CID 150760861) has the molecular formula C3H6N2S2
and a molecular weight of 134.23 g/mol. Its IUPAC name is 4,5-dihydro-1H-imidazole-4,5-dithiol.
Molecular Properties
| Compound Name | 4,5-dihydro-1H-imidazole-4,5-dithiol |
| PubChem CID | 150760861 |
| Molecular Formula | C3H6N2S2 |
| Molecular Weight | 134.23 g/mol |
| Exact Mass | 134.00 |
| IUPAC Name | 4,5-dihydro-1H-imidazole-4,5-dithiol |
| SMILES | SC1N=CNC1S |
| InChI | InChI=1S/C3H6N2S2/c6-2-3(7)5-1-4-2/h1-3,6-7H,(H,4,5) |
| InChIKey | JXUNWLDCGCXVCL-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-1H-imidazole-4,5-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-1H-imidazole-4,5-dithiol?
The IUPAC name of 4,5-dihydro-1H-imidazole-4,5-dithiol (CID 150760861) is 4,5-dihydro-1H-imidazole-4,5-dithiol.
What is the SMILES notation for 4,5-dihydro-1H-imidazole-4,5-dithiol?
The canonical SMILES for 4,5-dihydro-1H-imidazole-4,5-dithiol is SC1N=CNC1S.
What is the InChIKey of 4,5-dihydro-1H-imidazole-4,5-dithiol?
The InChIKey is JXUNWLDCGCXVCL-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6N2S2/c6-2-3(7)5-1-4-2/h1-3,6-7H,(H,4,5).
What are the key properties of 4,5-dihydro-1H-imidazole-4,5-dithiol?
4,5-dihydro-1H-imidazole-4,5-dithiol has a molecular weight of 134.23 g/mol, XLogP of 0.13, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-1H-imidazole-4,5-dithiol is sourced from PubChem (CID 150760861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).