C20H22N4O4 — CID 150767648
[1-[2-cyano-4-(2-formylpyrimidin-4-yl)phenoxy]-2,4-dimethylpentan-2-yl] carbamate (PubChem CID 150767648) has the molecular formula C20H22N4O4 and a molecular weight of 382.42 g/mol. Its IUPAC name is [1-[2-cyano-4-(2-formylpyrimidin-4-yl)phenoxy]-2,4-dimethylpentan-2-yl] carbamate.
| Compound Name | [1-[2-cyano-4-(2-formylpyrimidin-4-yl)phenoxy]-2,4-dimethylpentan-2-yl] carbamate |
|---|---|
| PubChem CID | 150767648 |
| Molecular Formula | C20H22N4O4 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | [1-[2-cyano-4-(2-formylpyrimidin-4-yl)phenoxy]-2,4-dimethylpentan-2-yl] carbamate |
| SMILES | CC(C)CC(C)(COc1ccc(-c2ccnc(C=O)n2)cc1C#N)OC(N)=O |
| InChI | InChI=1S/C20H22N4O4/c1-13(2)9-20(3,28-19(22)26)12-27-17-5-4-14(8-15(17)10-21)16-6-7-23-18(11-25)24-16/h4-8,11,13H,9,12H2,1-3H3,(H2,22,26) |
| InChIKey | JZEJRPUDZULDQI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 128.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|