About 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile
6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile (PubChem CID 150768660) has the molecular formula C12H16N4
and a molecular weight of 216.29 g/mol. Its IUPAC name is 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile |
| PubChem CID | 150768660 |
| Molecular Formula | C12H16N4 |
| Molecular Weight | 216.29 g/mol |
| Exact Mass | 216.14 |
| IUPAC Name | 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile |
| SMILES | C[C@H]1CN(C)CCN1c1cccc(C#N)n1 |
| InChI | InChI=1S/C12H16N4/c1-10-9-15(2)6-7-16(10)12-5-3-4-11(8-13)14-12/h3-5,10H,6-7,9H2,1-2H3/t10-/m0/s1 |
| InChIKey | JZJRQBAJFIVXDO-JTQLQIEISA-N |
| XLogP | 1.09 |
| TPSA | 43.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.29 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile?
The IUPAC name of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile (CID 150768660) is 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile.
What is the SMILES notation for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile?
The canonical SMILES for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile is C[C@H]1CN(C)CCN1c1cccc(C#N)n1.
What is the InChIKey of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile?
The InChIKey is JZJRQBAJFIVXDO-JTQLQIEISA-N. The full InChI is InChI=1S/C12H16N4/c1-10-9-15(2)6-7-16(10)12-5-3-4-11(8-13)14-12/h3-5,10H,6-7,9H2,1-2H3/t10-/m0/s1.
What are the key properties of 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile?
6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile has a molecular weight of 216.29 g/mol, XLogP of 1.09, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(2S)-2,4-dimethylpiperazin-1-yl]pyridine-2-carbonitrile is sourced from PubChem (CID 150768660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).