About bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone
bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone (PubChem CID 150769865) has the molecular formula C15H20N2OS2
and a molecular weight of 308.47 g/mol. Its IUPAC name is bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone.
Molecular Properties
| Compound Name | bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone |
| PubChem CID | 150769865 |
| Molecular Formula | C15H20N2OS2 |
| Molecular Weight | 308.47 g/mol |
| Exact Mass | 308.10 |
| IUPAC Name | bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone |
| SMILES | CC(C)Cc1nc(C(=O)c2csc(CC(C)C)n2)cs1 |
| InChI | InChI=1S/C15H20N2OS2/c1-9(2)5-13-16-11(7-19-13)15(18)12-8-20-14(17-12)6-10(3)4/h7-10H,5-6H2,1-4H3 |
| InChIKey | JZQBJHVBKOWINN-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.47 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The IUPAC name of bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone (CID 150769865) is bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone.
What is the SMILES notation for bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The canonical SMILES for bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone is CC(C)Cc1nc(C(=O)c2csc(CC(C)C)n2)cs1.
What is the InChIKey of bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
The InChIKey is JZQBJHVBKOWINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2OS2/c1-9(2)5-13-16-11(7-19-13)15(18)12-8-20-14(17-12)6-10(3)4/h7-10H,5-6H2,1-4H3.
What are the key properties of bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone?
bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone has a molecular weight of 308.47 g/mol, XLogP of 4.23, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis[2-(2-methylpropyl)-1,3-thiazol-4-yl]methanone is sourced from PubChem (CID 150769865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).