C18H14N2O4S — CID 15077099
18-ethyl-18-hydroxy-16-oxa-7-thia-3,12-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),5,9,14(19)-hexaene-13,17-dione (PubChem CID 15077099) has the molecular formula C18H14N2O4S and a molecular weight of 354.39 g/mol. Its IUPAC name is 18-ethyl-18-hydroxy-16-oxa-7-thia-3,12-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),5,9,14(19)-hexaene-13,17-dione.
| Compound Name | 18-ethyl-18-hydroxy-16-oxa-7-thia-3,12-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),5,9,14(19)-hexaene-13,17-dione |
|---|---|
| PubChem CID | 15077099 |
| Molecular Formula | C18H14N2O4S |
| Molecular Weight | 354.39 g/mol |
| Exact Mass | 354.07 |
| IUPAC Name | 18-ethyl-18-hydroxy-16-oxa-7-thia-3,12-diazapentacyclo[10.8.0.02,10.04,8.014,19]icosa-1(20),2,4(8),5,9,14(19)-hexaene-13,17-dione |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2cc3sccc3nc2-1 |
| InChI | InChI=1S/C18H14N2O4S/c1-2-18(23)11-6-13-15-9(5-14-12(19-15)3-4-25-14)7-20(13)16(21)10(11)8-24-17(18)22/h3-6,23H,2,7-8H2,1H3 |
| InChIKey | MOZBJUOBHJHCIP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.39 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |