C18H12F4O3 — CID 150773973
5-tert-butyl-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione (PubChem CID 150773973) has the molecular formula C18H12F4O3 and a molecular weight of 352.28 g/mol. Its IUPAC name is 5-tert-butyl-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione.
| Compound Name | 5-tert-butyl-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 150773973 |
| Molecular Formula | C18H12F4O3 |
| Molecular Weight | 352.28 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 5-tert-butyl-1,2,3,4-tetrafluoro-8-hydroxyanthracene-9,10-dione |
| SMILES | CC(C)(C)c1ccc(O)c2c1C(=O)c1c(F)c(F)c(F)c(F)c1C2=O |
| InChI | InChI=1S/C18H12F4O3/c1-18(2,3)6-4-5-7(23)9-8(6)16(24)10-11(17(9)25)13(20)15(22)14(21)12(10)19/h4-5,23H,1-3H3 |
| InChIKey | KALRTYCWZJHAGC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.28 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|