C12H14N2O2S — CID 15077503
2-(3,4-dimethoxyphenyl)sulfanyl-1-methylimidazole (PubChem CID 15077503) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)sulfanyl-1-methylimidazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-methylimidazole |
|---|---|
| PubChem CID | 15077503 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)sulfanyl-1-methylimidazole |
| SMILES | COc1ccc(Sc2nccn2C)cc1OC |
| InChI | InChI=1S/C12H14N2O2S/c1-14-7-6-13-12(14)17-9-4-5-10(15-2)11(8-9)16-3/h4-8H,1-3H3 |
| InChIKey | UQNNIGUQHSFPRY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |