About 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide
3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide (PubChem CID 150775399) has the molecular formula C19H18N2O2S
and a molecular weight of 338.43 g/mol. Its IUPAC name is 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide.
Molecular Properties
| Compound Name | 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide |
| PubChem CID | 150775399 |
| Molecular Formula | C19H18N2O2S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide |
| SMILES | CCCOc1c(C(N)=O)cc(-c2nccs2)cc1-c1ccccc1 |
| InChI | InChI=1S/C19H18N2O2S/c1-2-9-23-17-15(13-6-4-3-5-7-13)11-14(12-16(17)18(20)22)19-21-8-10-24-19/h3-8,10-12H,2,9H2,1H3,(H2,20,22) |
| InChIKey | KATLVYLMGRNCON-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 65.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide?
The IUPAC name of 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide (CID 150775399) is 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide.
What is the SMILES notation for 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide?
The canonical SMILES for 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide is CCCOc1c(C(N)=O)cc(-c2nccs2)cc1-c1ccccc1.
What is the InChIKey of 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide?
The InChIKey is KATLVYLMGRNCON-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H18N2O2S/c1-2-9-23-17-15(13-6-4-3-5-7-13)11-14(12-16(17)18(20)22)19-21-8-10-24-19/h3-8,10-12H,2,9H2,1H3,(H2,20,22).
What are the key properties of 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide?
3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide has a molecular weight of 338.43 g/mol, XLogP of 4.36, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-phenyl-2-propoxy-5-(1,3-thiazol-2-yl)benzamide is sourced from PubChem (CID 150775399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).