About 3-methyl-1-nitrosobutane
3-methyl-1-nitrosobutane (PubChem CID 15077589) has the molecular formula C5H11NO
and a molecular weight of 101.15 g/mol. Its IUPAC name is 3-methyl-1-nitrosobutane.
Molecular Properties
| Compound Name | 3-methyl-1-nitrosobutane |
| PubChem CID | 15077589 |
| Molecular Formula | C5H11NO |
| Molecular Weight | 101.15 g/mol |
| Exact Mass | 101.08 |
| IUPAC Name | 3-methyl-1-nitrosobutane |
| SMILES | CC(C)CCN=O |
| InChI | InChI=1S/C5H11NO/c1-5(2)3-4-6-7/h5H,3-4H2,1-2H3 |
| InChIKey | QFCZWYVVTVKGKT-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 101.15 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methyl-1-nitrosobutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-1-nitrosobutane?
The IUPAC name of 3-methyl-1-nitrosobutane (CID 15077589) is 3-methyl-1-nitrosobutane.
What is the SMILES notation for 3-methyl-1-nitrosobutane?
The canonical SMILES for 3-methyl-1-nitrosobutane is CC(C)CCN=O.
What is the InChIKey of 3-methyl-1-nitrosobutane?
The InChIKey is QFCZWYVVTVKGKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO/c1-5(2)3-4-6-7/h5H,3-4H2,1-2H3.
What are the key properties of 3-methyl-1-nitrosobutane?
3-methyl-1-nitrosobutane has a molecular weight of 101.15 g/mol, XLogP of 1.80, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-1-nitrosobutane is sourced from PubChem (CID 15077589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).