C14H20N4O4 — CID 15077645
4-[(1R,2R)-2-(3,5-dioxopiperazin-1-yl)cyclohexyl]piperazine-2,6-dione (PubChem CID 15077645) has the molecular formula C14H20N4O4 and a molecular weight of 308.34 g/mol. Its IUPAC name is 4-[(1R,2R)-2-(3,5-dioxopiperazin-1-yl)cyclohexyl]piperazine-2,6-dione.
| Compound Name | 4-[(1R,2R)-2-(3,5-dioxopiperazin-1-yl)cyclohexyl]piperazine-2,6-dione |
|---|---|
| PubChem CID | 15077645 |
| Molecular Formula | C14H20N4O4 |
| Molecular Weight | 308.34 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 4-[(1R,2R)-2-(3,5-dioxopiperazin-1-yl)cyclohexyl]piperazine-2,6-dione |
| SMILES | O=C1CN([C@@H]2CCCC[C@H]2N2CC(=O)NC(=O)C2)CC(=O)N1 |
| InChI | InChI=1S/C14H20N4O4/c19-11-5-17(6-12(20)15-11)9-3-1-2-4-10(9)18-7-13(21)16-14(22)8-18/h9-10H,1-8H2,(H,15,19,20)(H,16,21,22)/t9-,10-/m1/s1 |
| InChIKey | NFOMSYBJOILKIS-NXEZZACHSA-N |
| XLogP | -1.79 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.34 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|