C10H16BN3O4 — CID 150778422
[2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]pyrimidin-5-yl]boronic acid (PubChem CID 150778422) has the molecular formula C10H16BN3O4 and a molecular weight of 253.07 g/mol. Its IUPAC name is [2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]pyrimidin-5-yl]boronic acid.
| Compound Name | [2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 150778422 |
| Molecular Formula | C10H16BN3O4 |
| Molecular Weight | 253.07 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | [2-[(3-methoxy-2,2-dimethyl-3-oxopropyl)amino]pyrimidin-5-yl]boronic acid |
| SMILES | COC(=O)C(C)(C)CNc1ncc(B(O)O)cn1 |
| InChI | InChI=1S/C10H16BN3O4/c1-10(2,8(15)18-3)6-14-9-12-4-7(5-13-9)11(16)17/h4-5,16-17H,6H2,1-3H3,(H,12,13,14) |
| InChIKey | KBIWEJIOGGQBIO-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 104.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.07 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|