C13H14N4O2 — CID 150782787
(9R,13R)-4-cyano-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid (PubChem CID 150782787) has the molecular formula C13H14N4O2 and a molecular weight of 258.28 g/mol. Its IUPAC name is (9R,13R)-4-cyano-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid.
| Compound Name | (9R,13R)-4-cyano-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
|---|---|
| PubChem CID | 150782787 |
| Molecular Formula | C13H14N4O2 |
| Molecular Weight | 258.28 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | (9R,13R)-4-cyano-13-methyl-1,3,11-triazatricyclo[7.4.0.02,7]trideca-2(7),3,5-triene-11-carboxylic acid |
| SMILES | C[C@@H]1CN(C(=O)O)C[C@H]2Cc3ccc(C#N)nc3N21 |
| InChI | InChI=1S/C13H14N4O2/c1-8-6-16(13(18)19)7-11-4-9-2-3-10(5-14)15-12(9)17(8)11/h2-3,8,11H,4,6-7H2,1H3,(H,18,19)/t8-,11-/m1/s1 |
| InChIKey | KCFQAKITMNXLFX-LDYMZIIASA-N |
| XLogP | 1.07 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.28 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |