C24H34N6O5S2Si — CID 150786122
[7-[(2R)-3-azido-2-triethylsilyloxypropyl]sulfanylimidazo[5,1-b][1,3]thiazol-2-yl] (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate (PubChem CID 150786122) has the molecular formula C24H34N6O5S2Si and a molecular weight of 578.79 g/mol. Its IUPAC name is [7-[(2R)-3-azido-2-triethylsilyloxypropyl]sulfanylimidazo[5,1-b][1,3]thiazol-2-yl] (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate.
| Compound Name | [7-[(2R)-3-azido-2-triethylsilyloxypropyl]sulfanylimidazo[5,1-b][1,3]thiazol-2-yl] (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 150786122 |
| Molecular Formula | C24H34N6O5S2Si |
| Molecular Weight | 578.79 g/mol |
| Exact Mass | 578.18 |
| IUPAC Name | [7-[(2R)-3-azido-2-triethylsilyloxypropyl]sulfanylimidazo[5,1-b][1,3]thiazol-2-yl] (5R)-6-[(1R)-1-hydroxyethyl]-4-methyl-7-oxo-1-azabicyclo[3.2.0]hept-2-ene-2-carboxylate |
| SMILES | CC[Si](CC)(CC)O[C@H](CN=[N+]=[N-])CSc1ncn2cc(OC(=O)C3=CC(C)[C@@H]4C([C@@H](C)O)C(=O)N34)sc12 |
| InChI | InChI=1S/C24H34N6O5S2Si/c1-6-38(7-2,8-3)35-16(10-27-28-25)12-36-21-23-29(13-26-21)11-18(37-23)34-24(33)17-9-14(4)20-19(15(5)31)22(32)30(17)20/h9,11,13-16,19-20,31H,6-8,10,12H2,1-5H3/t14?,15-,16-,19?,20-/m1/s1 |
| InChIKey | KCWSNBOINXLLMI-MLYWPQLKSA-N |
| XLogP | 4.84 |
| TPSA | 142.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.79 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|