About 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid
3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid (PubChem CID 150786345) has the molecular formula C15H13Cl2FN2O5
and a molecular weight of 391.18 g/mol. Its IUPAC name is 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid.
Molecular Properties
| Compound Name | 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid |
| PubChem CID | 150786345 |
| Molecular Formula | C15H13Cl2FN2O5 |
| Molecular Weight | 391.18 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid |
| SMILES | CC/C(=N\C1CC1)C(C(=O)O)=C(O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl |
| InChI | InChI=1S/C15H13Cl2FN2O5/c1-2-9(19-6-3-4-6)10(15(22)23)14(21)7-5-8(18)12(17)13(11(7)16)20(24)25/h5-6,21H,2-4H2,1H3,(H,22,23)/b14-10?,19-9+ |
| InChIKey | XANDXWUIRGNKTC-IFOLDJBQSA-N |
| XLogP | 4.41 |
| TPSA | 113.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid?
The IUPAC name of 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid (CID 150786345) is 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid.
What is the SMILES notation for 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid?
The canonical SMILES for 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid is CC/C(=N\C1CC1)C(C(=O)O)=C(O)c1cc(F)c(Cl)c([N+](=O)[O-])c1Cl.
What is the InChIKey of 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid?
The InChIKey is XANDXWUIRGNKTC-IFOLDJBQSA-N. The full InChI is InChI=1S/C15H13Cl2FN2O5/c1-2-9(19-6-3-4-6)10(15(22)23)14(21)7-5-8(18)12(17)13(11(7)16)20(24)25/h5-6,21H,2-4H2,1H3,(H,22,23)/b14-10?,19-9+.
What are the key properties of 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid?
3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid has a molecular weight of 391.18 g/mol, XLogP of 4.41, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylimino-2-[(2,4-dichloro-5-fluoro-3-nitrophenyl)-hydroxymethylidene]pentanoic acid is sourced from PubChem (CID 150786345), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).