About 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide
7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide (PubChem CID 15078777) has the molecular formula C10H9NO4
and a molecular weight of 207.19 g/mol. Its IUPAC name is 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide.
Molecular Properties
| Compound Name | 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide |
| PubChem CID | 15078777 |
| Molecular Formula | C10H9NO4 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.05 |
| IUPAC Name | 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide |
| SMILES | NC(=O)C1CC(=O)c2ccc(O)cc2O1 |
| InChI | InChI=1S/C10H9NO4/c11-10(14)9-4-7(13)6-2-1-5(12)3-8(6)15-9/h1-3,9,12H,4H2,(H2,11,14) |
| InChIKey | SLZRKGNBIOFUDB-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide?
The IUPAC name of 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide (CID 15078777) is 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide.
What is the SMILES notation for 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide?
The canonical SMILES for 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide is NC(=O)C1CC(=O)c2ccc(O)cc2O1.
What is the InChIKey of 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide?
The InChIKey is SLZRKGNBIOFUDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO4/c11-10(14)9-4-7(13)6-2-1-5(12)3-8(6)15-9/h1-3,9,12H,4H2,(H2,11,14).
What are the key properties of 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide?
7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide has a molecular weight of 207.19 g/mol, XLogP of 0.21, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hydroxy-4-oxo-2,3-dihydrochromene-2-carboxamide is sourced from PubChem (CID 15078777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).