About 3-bromooxiran-2-one
3-bromooxiran-2-one (PubChem CID 150788377) has the molecular formula C2HBrO2
and a molecular weight of 136.93 g/mol. Its IUPAC name is 3-bromooxiran-2-one.
Molecular Properties
| Compound Name | 3-bromooxiran-2-one |
| PubChem CID | 150788377 |
| Molecular Formula | C2HBrO2 |
| Molecular Weight | 136.93 g/mol |
| Exact Mass | 135.92 |
| IUPAC Name | 3-bromooxiran-2-one |
| SMILES | O=C1OC1Br |
| InChI | InChI=1S/C2HBrO2/c3-1-2(4)5-1/h1H |
| InChIKey | KDIDNHZDMCBNLA-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.93 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-bromooxiran-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromooxiran-2-one?
The IUPAC name of 3-bromooxiran-2-one (CID 150788377) is 3-bromooxiran-2-one.
What is the SMILES notation for 3-bromooxiran-2-one?
The canonical SMILES for 3-bromooxiran-2-one is O=C1OC1Br.
What is the InChIKey of 3-bromooxiran-2-one?
The InChIKey is KDIDNHZDMCBNLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HBrO2/c3-1-2(4)5-1/h1H.
What are the key properties of 3-bromooxiran-2-one?
3-bromooxiran-2-one has a molecular weight of 136.93 g/mol, XLogP of 0.26, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromooxiran-2-one is sourced from PubChem (CID 150788377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).