About 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone
1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone (PubChem CID 150788539) has the molecular formula C17H11ClI2O3
and a molecular weight of 552.53 g/mol. Its IUPAC name is 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone.
Molecular Properties
| Compound Name | 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone |
| PubChem CID | 150788539 |
| Molecular Formula | C17H11ClI2O3 |
| Molecular Weight | 552.53 g/mol |
| Exact Mass | 551.85 |
| IUPAC Name | 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone |
| SMILES | O=C(c1cc(I)c(OCCCl)c(I)c1)c1coc2ccccc12 |
| InChI | InChI=1S/C17H11ClI2O3/c18-5-6-22-17-13(19)7-10(8-14(17)20)16(21)12-9-23-15-4-2-1-3-11(12)15/h1-4,7-9H,5-6H2 |
| InChIKey | KDIXGKHSOCUDEU-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 552.53 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone?
The IUPAC name of 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone (CID 150788539) is 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone.
What is the SMILES notation for 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone?
The canonical SMILES for 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone is O=C(c1cc(I)c(OCCCl)c(I)c1)c1coc2ccccc12.
What is the InChIKey of 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone?
The InChIKey is KDIXGKHSOCUDEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11ClI2O3/c18-5-6-22-17-13(19)7-10(8-14(17)20)16(21)12-9-23-15-4-2-1-3-11(12)15/h1-4,7-9H,5-6H2.
What are the key properties of 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone?
1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone has a molecular weight of 552.53 g/mol, XLogP of 5.49, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-3-yl-[4-(2-chloroethoxy)-3,5-diiodophenyl]methanone is sourced from PubChem (CID 150788539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).