About 4aH-carbazol-1-ol
4aH-carbazol-1-ol (PubChem CID 150788845) has the molecular formula C12H9NO
and a molecular weight of 183.21 g/mol. Its IUPAC name is 4aH-carbazol-1-ol.
Molecular Properties
| Compound Name | 4aH-carbazol-1-ol |
| PubChem CID | 150788845 |
| Molecular Formula | C12H9NO |
| Molecular Weight | 183.21 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 4aH-carbazol-1-ol |
| SMILES | OC1=CC=CC2C1=Nc1ccccc12 |
| InChI | InChI=1S/C12H9NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,9,14H |
| InChIKey | KDKNOJMFTFZSIC-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4aH-carbazol-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4aH-carbazol-1-ol?
The IUPAC name of 4aH-carbazol-1-ol (CID 150788845) is 4aH-carbazol-1-ol.
What is the SMILES notation for 4aH-carbazol-1-ol?
The canonical SMILES for 4aH-carbazol-1-ol is OC1=CC=CC2C1=Nc1ccccc12.
What is the InChIKey of 4aH-carbazol-1-ol?
The InChIKey is KDKNOJMFTFZSIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO/c14-11-7-3-5-9-8-4-1-2-6-10(8)13-12(9)11/h1-7,9,14H.
What are the key properties of 4aH-carbazol-1-ol?
4aH-carbazol-1-ol has a molecular weight of 183.21 g/mol, XLogP of 2.87, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4aH-carbazol-1-ol is sourced from PubChem (CID 150788845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).