About N-(2-methylpropyl)nona-2,6,8-trien-1-amine
N-(2-methylpropyl)nona-2,6,8-trien-1-amine (PubChem CID 150789104) has the molecular formula C13H23N
and a molecular weight of 193.33 g/mol. Its IUPAC name is N-(2-methylpropyl)nona-2,6,8-trien-1-amine.
Molecular Properties
| Compound Name | N-(2-methylpropyl)nona-2,6,8-trien-1-amine |
| PubChem CID | 150789104 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-(2-methylpropyl)nona-2,6,8-trien-1-amine |
| SMILES | C=CC=CCCC=CCNCC(C)C |
| InChI | InChI=1S/C13H23N/c1-4-5-6-7-8-9-10-11-14-12-13(2)3/h4-6,9-10,13-14H,1,7-8,11-12H2,2-3H3 |
| InChIKey | KDLTZFSGQCURGD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-(2-methylpropyl)nona-2,6,8-trien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-methylpropyl)nona-2,6,8-trien-1-amine?
The IUPAC name of N-(2-methylpropyl)nona-2,6,8-trien-1-amine (CID 150789104) is N-(2-methylpropyl)nona-2,6,8-trien-1-amine.
What is the SMILES notation for N-(2-methylpropyl)nona-2,6,8-trien-1-amine?
The canonical SMILES for N-(2-methylpropyl)nona-2,6,8-trien-1-amine is C=CC=CCCC=CCNCC(C)C.
What is the InChIKey of N-(2-methylpropyl)nona-2,6,8-trien-1-amine?
The InChIKey is KDLTZFSGQCURGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H23N/c1-4-5-6-7-8-9-10-11-14-12-13(2)3/h4-6,9-10,13-14H,1,7-8,11-12H2,2-3H3.
What are the key properties of N-(2-methylpropyl)nona-2,6,8-trien-1-amine?
N-(2-methylpropyl)nona-2,6,8-trien-1-amine has a molecular weight of 193.33 g/mol, XLogP of 3.31, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-methylpropyl)nona-2,6,8-trien-1-amine is sourced from PubChem (CID 150789104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).