C13H23N — CID 150789104
N-(2-methylpropyl)nona-2,6,8-trien-1-amine (PubChem CID 150789104) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is N-(2-methylpropyl)nona-2,6,8-trien-1-amine.
| Compound Name | N-(2-methylpropyl)nona-2,6,8-trien-1-amine |
|---|---|
| PubChem CID | 150789104 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | N-(2-methylpropyl)nona-2,6,8-trien-1-amine |
| SMILES | C=CC=CCCC=CCNCC(C)C |
| InChI | InChI=1S/C13H23N/c1-4-5-6-7-8-9-10-11-14-12-13(2)3/h4-6,9-10,13-14H,1,7-8,11-12H2,2-3H3 |
| InChIKey | KDLTZFSGQCURGD-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|