C24H44O2 — CID 150790956
2,3,5,6-tetramethyl-2,3-bis(oct-7-enyl)-1,4-dioxane (PubChem CID 150790956) has the molecular formula C24H44O2 and a molecular weight of 364.61 g/mol. Its IUPAC name is 2,3,5,6-tetramethyl-2,3-bis(oct-7-enyl)-1,4-dioxane.
| Compound Name | 2,3,5,6-tetramethyl-2,3-bis(oct-7-enyl)-1,4-dioxane |
|---|---|
| PubChem CID | 150790956 |
| Molecular Formula | C24H44O2 |
| Molecular Weight | 364.61 g/mol |
| Exact Mass | 364.33 |
| IUPAC Name | 2,3,5,6-tetramethyl-2,3-bis(oct-7-enyl)-1,4-dioxane |
| SMILES | C=CCCCCCCC1(C)OC(C)C(C)OC1(C)CCCCCCC=C |
| InChI | InChI=1S/C24H44O2/c1-7-9-11-13-15-17-19-23(5)24(6,26-22(4)21(3)25-23)20-18-16-14-12-10-8-2/h7-8,21-22H,1-2,9-20H2,3-6H3 |
| InChIKey | KDVMLVNAMGTTIC-UHFFFAOYSA-N |
| XLogP | 7.38 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.61 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|