About N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide
N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide (PubChem CID 150791979) has the molecular formula C16H17F3N3O2+
and a molecular weight of 340.33 g/mol. Its IUPAC name is N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide.
Molecular Properties
| Compound Name | N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide |
| PubChem CID | 150791979 |
| Molecular Formula | C16H17F3N3O2+ |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide |
| SMILES | CC(=O)Nc1ccc[n+](C(C)c2ccc(OCC(F)(F)F)nc2)c1 |
| InChI | InChI=1S/C16H16F3N3O2/c1-11(22-7-3-4-14(9-22)21-12(2)23)13-5-6-15(20-8-13)24-10-16(17,18)19/h3-9,11H,10H2,1-2H3/p+1 |
| InChIKey | KEAULFQMPWWOLB-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide?
The IUPAC name of N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide (CID 150791979) is N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide.
What is the SMILES notation for N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide?
The canonical SMILES for N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide is CC(=O)Nc1ccc[n+](C(C)c2ccc(OCC(F)(F)F)nc2)c1.
What is the InChIKey of N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide?
The InChIKey is KEAULFQMPWWOLB-UHFFFAOYSA-O. The full InChI is InChI=1S/C16H16F3N3O2/c1-11(22-7-3-4-14(9-22)21-12(2)23)13-5-6-15(20-8-13)24-10-16(17,18)19/h3-9,11H,10H2,1-2H3/p+1.
What are the key properties of N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide?
N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide has a molecular weight of 340.33 g/mol, XLogP of 2.88, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[1-[1-[6-(2,2,2-trifluoroethoxy)-3-pyridinyl]ethyl]pyridin-1-ium-3-yl]acetamide is sourced from PubChem (CID 150791979), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).