C11H11FO6 — CID 150795709
4-[(2-fluorophenyl)methoxy]-2,3-dihydroxy-4-oxobutanoic acid (PubChem CID 150795709) has the molecular formula C11H11FO6 and a molecular weight of 258.20 g/mol. Its IUPAC name is 4-[(2-fluorophenyl)methoxy]-2,3-dihydroxy-4-oxobutanoic acid.
| Compound Name | 4-[(2-fluorophenyl)methoxy]-2,3-dihydroxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 150795709 |
| Molecular Formula | C11H11FO6 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.05 |
| IUPAC Name | 4-[(2-fluorophenyl)methoxy]-2,3-dihydroxy-4-oxobutanoic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C11H11FO6/c12-7-4-2-1-3-6(7)5-18-11(17)9(14)8(13)10(15)16/h1-4,8-9,13-14H,5H2,(H,15,16) |
| InChIKey | KEUIIPXUARYKPV-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |