C26H26N3OP — CID 150795814
(1R,2S)-N'-diphenylphosphoryl-1-(6-methyl-2-pyridinyl)-2-phenylethane-1,2-diamine (PubChem CID 150795814) has the molecular formula C26H26N3OP and a molecular weight of 427.49 g/mol. Its IUPAC name is (1R,2S)-N'-diphenylphosphoryl-1-(6-methyl-2-pyridinyl)-2-phenylethane-1,2-diamine.
| Compound Name | (1R,2S)-N'-diphenylphosphoryl-1-(6-methyl-2-pyridinyl)-2-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 150795814 |
| Molecular Formula | C26H26N3OP |
| Molecular Weight | 427.49 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | (1R,2S)-N'-diphenylphosphoryl-1-(6-methyl-2-pyridinyl)-2-phenylethane-1,2-diamine |
| SMILES | Cc1cccc([C@H](N)[C@@H](NP(=O)(c2ccccc2)c2ccccc2)c2ccccc2)n1 |
| InChI | InChI=1S/C26H26N3OP/c1-20-12-11-19-24(28-20)25(27)26(21-13-5-2-6-14-21)29-31(30,22-15-7-3-8-16-22)23-17-9-4-10-18-23/h2-19,25-26H,27H2,1H3,(H,29,30)/t25-,26-/m0/s1 |
| InChIKey | KEUTWLHSCJKTSU-UIOOFZCWSA-N |
| XLogP | 4.65 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.49 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|