About (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide
(R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide (PubChem CID 150795926) has the molecular formula C12H15F3INOS
and a molecular weight of 405.22 g/mol. Its IUPAC name is (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide.
Molecular Properties
| Compound Name | (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide |
| PubChem CID | 150795926 |
| Molecular Formula | C12H15F3INOS |
| Molecular Weight | 405.22 g/mol |
| Exact Mass | 404.99 |
| IUPAC Name | (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide |
| SMILES | CC(C)[S@@](=O)N(C)[C@@H](c1ccc(I)cc1)C(F)(F)F |
| InChI | InChI=1S/C12H15F3INOS/c1-8(2)19(18)17(3)11(12(13,14)15)9-4-6-10(16)7-5-9/h4-8,11H,1-3H3/t11-,19+/m0/s1 |
| InChIKey | KEVHPYSIOYQATO-JEOXALJRSA-N |
| XLogP | 3.90 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.22 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide?
The IUPAC name of (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide (CID 150795926) is (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide.
What is the SMILES notation for (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide?
The canonical SMILES for (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide is CC(C)[S@@](=O)N(C)[C@@H](c1ccc(I)cc1)C(F)(F)F.
What is the InChIKey of (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide?
The InChIKey is KEVHPYSIOYQATO-JEOXALJRSA-N. The full InChI is InChI=1S/C12H15F3INOS/c1-8(2)19(18)17(3)11(12(13,14)15)9-4-6-10(16)7-5-9/h4-8,11H,1-3H3/t11-,19+/m0/s1.
What are the key properties of (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide?
(R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide has a molecular weight of 405.22 g/mol, XLogP of 3.90, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (R)-N-methyl-N-[(1S)-2,2,2-trifluoro-1-(4-iodophenyl)ethyl]propane-2-sulfinamide is sourced from PubChem (CID 150795926), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).