About 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol
2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol (PubChem CID 150798747) has the molecular formula C15H14O4
and a molecular weight of 258.27 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol.
Molecular Properties
| Compound Name | 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol |
| PubChem CID | 150798747 |
| Molecular Formula | C15H14O4 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.09 |
| IUPAC Name | 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol |
| SMILES | Oc1cccc(C2CCc3c(O)cc(O)cc3O2)c1 |
| InChI | InChI=1S/C15H14O4/c16-10-3-1-2-9(6-10)14-5-4-12-13(18)7-11(17)8-15(12)19-14/h1-3,6-8,14,16-18H,4-5H2 |
| InChIKey | KFKAPRTUCVPPRQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 69.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol?
The IUPAC name of 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol (CID 150798747) is 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol.
What is the SMILES notation for 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol?
The canonical SMILES for 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol is Oc1cccc(C2CCc3c(O)cc(O)cc3O2)c1.
What is the InChIKey of 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol?
The InChIKey is KFKAPRTUCVPPRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14O4/c16-10-3-1-2-9(6-10)14-5-4-12-13(18)7-11(17)8-15(12)19-14/h1-3,6-8,14,16-18H,4-5H2.
What are the key properties of 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol?
2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol has a molecular weight of 258.27 g/mol, XLogP of 2.87, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3-hydroxyphenyl)-3,4-dihydro-2H-chromene-5,7-diol is sourced from PubChem (CID 150798747), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).