About 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one
8-amino-6-cyclopropyl-1,7-dihydropurin-2-one (PubChem CID 150798826) has the molecular formula C8H9N5O
and a molecular weight of 191.19 g/mol. Its IUPAC name is 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one.
Molecular Properties
| Compound Name | 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one |
| PubChem CID | 150798826 |
| Molecular Formula | C8H9N5O |
| Molecular Weight | 191.19 g/mol |
| Exact Mass | 191.08 |
| IUPAC Name | 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one |
| SMILES | Nc1nc2nc(=O)[nH]c(C3CC3)c2[nH]1 |
| InChI | InChI=1S/C8H9N5O/c9-7-10-5-4(3-1-2-3)11-8(14)13-6(5)12-7/h3H,1-2H2,(H4,9,10,11,12,13,14) |
| InChIKey | KFKKFPYQRSHOHV-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 100.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.19 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one?
The IUPAC name of 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one (CID 150798826) is 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one.
What is the SMILES notation for 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one?
The canonical SMILES for 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one is Nc1nc2nc(=O)[nH]c(C3CC3)c2[nH]1.
What is the InChIKey of 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one?
The InChIKey is KFKKFPYQRSHOHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5O/c9-7-10-5-4(3-1-2-3)11-8(14)13-6(5)12-7/h3H,1-2H2,(H4,9,10,11,12,13,14).
What are the key properties of 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one?
8-amino-6-cyclopropyl-1,7-dihydropurin-2-one has a molecular weight of 191.19 g/mol, XLogP of 0.11, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-amino-6-cyclopropyl-1,7-dihydropurin-2-one is sourced from PubChem (CID 150798826), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).