C26H26F5N3O2S — CID 150800282
3-ethyl-1-methyl-1-[2,2,5-trimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]thiourea (PubChem CID 150800282) has the molecular formula C26H26F5N3O2S and a molecular weight of 539.57 g/mol. Its IUPAC name is 3-ethyl-1-methyl-1-[2,2,5-trimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]thiourea.
| Compound Name | 3-ethyl-1-methyl-1-[2,2,5-trimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]thiourea |
|---|---|
| PubChem CID | 150800282 |
| Molecular Formula | C26H26F5N3O2S |
| Molecular Weight | 539.57 g/mol |
| Exact Mass | 539.17 |
| IUPAC Name | 3-ethyl-1-methyl-1-[2,2,5-trimethyl-4-(3-oxo-1H-isoindol-2-yl)-6-(1,1,2,2,2-pentafluoroethyl)chromen-3-yl]thiourea |
| SMILES | CCNC(=S)N(C)C1=C(N2Cc3ccccc3C2=O)c2c(ccc(C(F)(F)C(F)(F)F)c2C)OC1(C)C |
| InChI | InChI=1S/C26H26F5N3O2S/c1-6-32-23(37)33(5)21-20(34-13-15-9-7-8-10-16(15)22(34)35)19-14(2)17(25(27,28)26(29,30)31)11-12-18(19)36-24(21,3)4/h7-12H,6,13H2,1-5H3,(H,32,37) |
| InChIKey | KFRZIJVGYFVZFG-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|