About 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one
2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one (PubChem CID 150800651) has the molecular formula C22H23N3O5
and a molecular weight of 409.44 g/mol. Its IUPAC name is 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one.
Molecular Properties
| Compound Name | 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one |
| PubChem CID | 150800651 |
| Molecular Formula | C22H23N3O5 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one |
| SMILES | CCONC1=C(N2Cc3ccccc3C2=O)c2c(ccc([N+](=O)[O-])c2C)OC1(C)C |
| InChI | InChI=1S/C22H23N3O5/c1-5-29-23-20-19(24-12-14-8-6-7-9-15(14)21(24)26)18-13(2)16(25(27)28)10-11-17(18)30-22(20,3)4/h6-11,23H,5,12H2,1-4H3 |
| InChIKey | KFTZVDQZLUFYGX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 93.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one?
The IUPAC name of 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one (CID 150800651) is 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one.
What is the SMILES notation for 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one?
The canonical SMILES for 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one is CCONC1=C(N2Cc3ccccc3C2=O)c2c(ccc([N+](=O)[O-])c2C)OC1(C)C.
What is the InChIKey of 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one?
The InChIKey is KFTZVDQZLUFYGX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23N3O5/c1-5-29-23-20-19(24-12-14-8-6-7-9-15(14)21(24)26)18-13(2)16(25(27)28)10-11-17(18)30-22(20,3)4/h6-11,23H,5,12H2,1-4H3.
What are the key properties of 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one?
2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one has a molecular weight of 409.44 g/mol, XLogP of 3.94, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(ethoxyamino)-2,2,5-trimethyl-6-nitrochromen-4-yl]-3H-isoindol-1-one is sourced from PubChem (CID 150800651), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).