C51H62N8OS2 — CID 150801178
2,4-bis[4-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]phenyl]pentan-3-one (PubChem CID 150801178) has the molecular formula C51H62N8OS2 and a molecular weight of 867.25 g/mol. Its IUPAC name is 2,4-bis[4-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]phenyl]pentan-3-one.
| Compound Name | 2,4-bis[4-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]phenyl]pentan-3-one |
|---|---|
| PubChem CID | 150801178 |
| Molecular Formula | C51H62N8OS2 |
| Molecular Weight | 867.25 g/mol |
| Exact Mass | 866.45 |
| IUPAC Name | 2,4-bis[4-[5-[2-[(2,2,6,6-tetramethylpiperidin-4-yl)amino]pyrimidin-4-yl]thiophen-2-yl]phenyl]pentan-3-one |
| SMILES | CC(C(=O)C(C)c1ccc(-c2ccc(-c3ccnc(NC4CC(C)(C)NC(C)(C)C4)n3)s2)cc1)c1ccc(-c2ccc(-c3ccnc(NC4CC(C)(C)NC(C)(C)C4)n3)s2)cc1 |
| InChI | InChI=1S/C51H62N8OS2/c1-31(33-11-15-35(16-12-33)41-19-21-43(61-41)39-23-25-52-46(56-39)54-37-27-48(3,4)58-49(5,6)28-37)45(60)32(2)34-13-17-36(18-14-34)42-20-22-44(62-42)40-24-26-53-47(57-40)55-38-29-50(7,8)59-51(9,10)30-38/h11-26,31-32,37-38,58-59H,27-30H2,1-10H3,(H,52,54,56)(H,53,55,57) |
| InChIKey | KFWXYNQYKPKHKK-UHFFFAOYSA-N |
| XLogP | 11.98 |
| TPSA | 116.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 62 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 867.25 |
| LogP ≤ 5 | 11.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |