About cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone
cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone (PubChem CID 150802725) has the molecular formula C13H18O2
and a molecular weight of 206.29 g/mol. Its IUPAC name is cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone.
Molecular Properties
| Compound Name | cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone |
| PubChem CID | 150802725 |
| Molecular Formula | C13H18O2 |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.13 |
| IUPAC Name | cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone |
| SMILES | COC1(C(=O)C2CCCCC2)C=CC=C1 |
| InChI | InChI=1S/C13H18O2/c1-15-13(9-5-6-10-13)12(14)11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3 |
| InChIKey | KGFCMAVRFUZTSA-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The IUPAC name of cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone (CID 150802725) is cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone.
What is the SMILES notation for cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The canonical SMILES for cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone is COC1(C(=O)C2CCCCC2)C=CC=C1.
What is the InChIKey of cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
The InChIKey is KGFCMAVRFUZTSA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18O2/c1-15-13(9-5-6-10-13)12(14)11-7-3-2-4-8-11/h5-6,9-11H,2-4,7-8H2,1H3.
What are the key properties of cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone?
cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone has a molecular weight of 206.29 g/mol, XLogP of 2.65, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-(1-methoxycyclopenta-2,4-dien-1-yl)methanone is sourced from PubChem (CID 150802725), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).