About 5-amino-2,3-dimethoxybenzoic acid
5-amino-2,3-dimethoxybenzoic acid (PubChem CID 15080676) has the molecular formula C9H11NO4
and a molecular weight of 197.19 g/mol. Its IUPAC name is 5-amino-2,3-dimethoxybenzoic acid.
Molecular Properties
| Compound Name | 5-amino-2,3-dimethoxybenzoic acid |
| PubChem CID | 15080676 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 5-amino-2,3-dimethoxybenzoic acid |
| SMILES | COc1cc(N)cc(C(=O)O)c1OC |
| InChI | InChI=1S/C9H11NO4/c1-13-7-4-5(10)3-6(9(11)12)8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12) |
| InChIKey | OTPAKSUZQLTXRB-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-amino-2,3-dimethoxybenzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-amino-2,3-dimethoxybenzoic acid?
The IUPAC name of 5-amino-2,3-dimethoxybenzoic acid (CID 15080676) is 5-amino-2,3-dimethoxybenzoic acid.
What is the SMILES notation for 5-amino-2,3-dimethoxybenzoic acid?
The canonical SMILES for 5-amino-2,3-dimethoxybenzoic acid is COc1cc(N)cc(C(=O)O)c1OC.
What is the InChIKey of 5-amino-2,3-dimethoxybenzoic acid?
The InChIKey is OTPAKSUZQLTXRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO4/c1-13-7-4-5(10)3-6(9(11)12)8(7)14-2/h3-4H,10H2,1-2H3,(H,11,12).
What are the key properties of 5-amino-2,3-dimethoxybenzoic acid?
5-amino-2,3-dimethoxybenzoic acid has a molecular weight of 197.19 g/mol, XLogP of 0.98, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-amino-2,3-dimethoxybenzoic acid is sourced from PubChem (CID 15080676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).