About 6H-pyrido[2,3-d]pyrimidine-7-thione
6H-pyrido[2,3-d]pyrimidine-7-thione (PubChem CID 150812210) has the molecular formula C7H5N3S
and a molecular weight of 163.20 g/mol. Its IUPAC name is 6H-pyrido[2,3-d]pyrimidine-7-thione.
Molecular Properties
| Compound Name | 6H-pyrido[2,3-d]pyrimidine-7-thione |
| PubChem CID | 150812210 |
| Molecular Formula | C7H5N3S |
| Molecular Weight | 163.20 g/mol |
| Exact Mass | 163.02 |
| IUPAC Name | 6H-pyrido[2,3-d]pyrimidine-7-thione |
| SMILES | S=C1CC=c2cncnc2=N1 |
| InChI | InChI=1S/C7H5N3S/c11-6-2-1-5-3-8-4-9-7(5)10-6/h1,3-4H,2H2 |
| InChIKey | KIDAAWXQOJRGIA-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 38.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.20 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 6H-pyrido[2,3-d]pyrimidine-7-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6H-pyrido[2,3-d]pyrimidine-7-thione?
The IUPAC name of 6H-pyrido[2,3-d]pyrimidine-7-thione (CID 150812210) is 6H-pyrido[2,3-d]pyrimidine-7-thione.
What is the SMILES notation for 6H-pyrido[2,3-d]pyrimidine-7-thione?
The canonical SMILES for 6H-pyrido[2,3-d]pyrimidine-7-thione is S=C1CC=c2cncnc2=N1.
What is the InChIKey of 6H-pyrido[2,3-d]pyrimidine-7-thione?
The InChIKey is KIDAAWXQOJRGIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5N3S/c11-6-2-1-5-3-8-4-9-7(5)10-6/h1,3-4H,2H2.
What are the key properties of 6H-pyrido[2,3-d]pyrimidine-7-thione?
6H-pyrido[2,3-d]pyrimidine-7-thione has a molecular weight of 163.20 g/mol, XLogP of -0.39, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6H-pyrido[2,3-d]pyrimidine-7-thione is sourced from PubChem (CID 150812210), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).