C23H30O6 — CID 15081414
9,15-diacetyloxyheptadeca-1,16-dien-11,13-diyn-8-yl acetate (PubChem CID 15081414) has the molecular formula C23H30O6 and a molecular weight of 402.49 g/mol. Its IUPAC name is 9,15-diacetyloxyheptadeca-1,16-dien-11,13-diyn-8-yl acetate.
| Compound Name | 9,15-diacetyloxyheptadeca-1,16-dien-11,13-diyn-8-yl acetate |
|---|---|
| PubChem CID | 15081414 |
| Molecular Formula | C23H30O6 |
| Molecular Weight | 402.49 g/mol |
| Exact Mass | 402.20 |
| IUPAC Name | 9,15-diacetyloxyheptadeca-1,16-dien-11,13-diyn-8-yl acetate |
| SMILES | C=CCCCCCC(OC(C)=O)C(CC#CC#CC(C=C)OC(C)=O)OC(C)=O |
| InChI | InChI=1S/C23H30O6/c1-6-8-9-10-13-16-22(28-19(4)25)23(29-20(5)26)17-14-11-12-15-21(7-2)27-18(3)24/h6-7,21-23H,1-2,8-10,13,16-17H2,3-5H3 |
| InChIKey | DJKKKMDXVJHGSD-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.49 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|